C24H22F3N5O5 — CID 124774371
(4'aS,5R)-3'-ethyl-8'-nitro-1-[3-(trifluoromethyl)phenyl]spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione (PubChem CID 124774371) has the molecular formula C24H22F3N5O5 and a molecular weight of 517.46 g/mol. Its IUPAC name is (4'aS,5R)-3'-ethyl-8'-nitro-1-[3-(trifluoromethyl)phenyl]spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione.
| Compound Name | (4'aS,5R)-3'-ethyl-8'-nitro-1-[3-(trifluoromethyl)phenyl]spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 124774371 |
| Molecular Formula | C24H22F3N5O5 |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | (4'aS,5R)-3'-ethyl-8'-nitro-1-[3-(trifluoromethyl)phenyl]spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
| SMILES | CCN1CCN2c3ccc([N+](=O)[O-])cc3C[C@]3(C(=O)NC(=O)N(c4cccc(C(F)(F)F)c4)C3=O)[C@H]2C1 |
| InChI | InChI=1S/C24H22F3N5O5/c1-2-29-8-9-30-18-7-6-17(32(36)37)10-14(18)12-23(19(30)13-29)20(33)28-22(35)31(21(23)34)16-5-3-4-15(11-16)24(25,26)27/h3-7,10-11,19H,2,8-9,12-13H2,1H3,(H,28,33,35)/t19-,23-/m1/s1 |
| InChIKey | ASLXUDMFQWJRRL-AUSIDOKSSA-N |
| XLogP | 2.95 |
| TPSA | 116.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|