C34H32F2N2O6 — CID 100886547
diethyl (4R,6R,7S)-2-amino-4-(2-fluorophenyl)-1-(3-fluorophenyl)-7-(3-methoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate (PubChem CID 100886547) has the molecular formula C34H32F2N2O6 and a molecular weight of 602.63 g/mol. Its IUPAC name is diethyl (4R,6R,7S)-2-amino-4-(2-fluorophenyl)-1-(3-fluorophenyl)-7-(3-methoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate.
| Compound Name | diethyl (4R,6R,7S)-2-amino-4-(2-fluorophenyl)-1-(3-fluorophenyl)-7-(3-methoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 100886547 |
| Molecular Formula | C34H32F2N2O6 |
| Molecular Weight | 602.63 g/mol |
| Exact Mass | 602.22 |
| IUPAC Name | diethyl (4R,6R,7S)-2-amino-4-(2-fluorophenyl)-1-(3-fluorophenyl)-7-(3-methoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
| SMILES | CCOC(=O)C1=C(N)N(c2cccc(F)c2)C2=C(C(=O)[C@H](C(=O)OCC)[C@@H](c3cccc(OC)c3)C2)[C@H]1c1ccccc1F |
| InChI | InChI=1S/C34H32F2N2O6/c1-4-43-33(40)28-24(19-10-8-13-22(16-19)42-3)18-26-29(31(28)39)27(23-14-6-7-15-25(23)36)30(34(41)44-5-2)32(37)38(26)21-12-9-11-20(35)17-21/h6-17,24,27-28H,4-5,18,37H2,1-3H3/t24-,27-,28-/m1/s1 |
| InChIKey | FDHFILKXBRXYCI-RYRVMRHHSA-N |
| XLogP | 5.50 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.63 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|