C31H28ClFN2O5S — CID 98068131
diethyl (4S,6S,7R)-2-amino-4-(3-chlorophenyl)-1-(3-fluorophenyl)-5-oxo-7-thiophen-2-yl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate (PubChem CID 98068131) has the molecular formula C31H28ClFN2O5S and a molecular weight of 595.09 g/mol. Its IUPAC name is diethyl (4S,6S,7R)-2-amino-4-(3-chlorophenyl)-1-(3-fluorophenyl)-5-oxo-7-thiophen-2-yl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate.
| Compound Name | diethyl (4S,6S,7R)-2-amino-4-(3-chlorophenyl)-1-(3-fluorophenyl)-5-oxo-7-thiophen-2-yl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 98068131 |
| Molecular Formula | C31H28ClFN2O5S |
| Molecular Weight | 595.09 g/mol |
| Exact Mass | 594.14 |
| IUPAC Name | diethyl (4S,6S,7R)-2-amino-4-(3-chlorophenyl)-1-(3-fluorophenyl)-5-oxo-7-thiophen-2-yl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
| SMILES | CCOC(=O)C1=C(N)N(c2cccc(F)c2)C2=C(C(=O)[C@@H](C(=O)OCC)[C@H](c3cccs3)C2)[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C31H28ClFN2O5S/c1-3-39-30(37)25-21(23-12-7-13-41-23)16-22-26(28(25)36)24(17-8-5-9-18(32)14-17)27(31(38)40-4-2)29(34)35(22)20-11-6-10-19(33)15-20/h5-15,21,24-25H,3-4,16,34H2,1-2H3/t21-,24-,25-/m0/s1 |
| InChIKey | OFWZCJZZDVQQKV-TUSQITKMSA-N |
| XLogP | 6.07 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.09 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|