C31H27ClF2N2O5S — CID 100887851
diethyl (4R,6R,7S)-2-amino-4-(3-chlorophenyl)-1-(2,4-difluorophenyl)-5-oxo-7-thiophen-2-yl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate (PubChem CID 100887851) has the molecular formula C31H27ClF2N2O5S and a molecular weight of 613.08 g/mol. Its IUPAC name is diethyl (4R,6R,7S)-2-amino-4-(3-chlorophenyl)-1-(2,4-difluorophenyl)-5-oxo-7-thiophen-2-yl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate.
| Compound Name | diethyl (4R,6R,7S)-2-amino-4-(3-chlorophenyl)-1-(2,4-difluorophenyl)-5-oxo-7-thiophen-2-yl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 100887851 |
| Molecular Formula | C31H27ClF2N2O5S |
| Molecular Weight | 613.08 g/mol |
| Exact Mass | 612.13 |
| IUPAC Name | diethyl (4R,6R,7S)-2-amino-4-(3-chlorophenyl)-1-(2,4-difluorophenyl)-5-oxo-7-thiophen-2-yl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
| SMILES | CCOC(=O)C1=C(N)N(c2ccc(F)cc2F)C2=C(C(=O)[C@H](C(=O)OCC)[C@@H](c3cccs3)C2)[C@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C31H27ClF2N2O5S/c1-3-40-30(38)25-19(23-9-6-12-42-23)15-22-26(28(25)37)24(16-7-5-8-17(32)13-16)27(31(39)41-4-2)29(35)36(22)21-11-10-18(33)14-20(21)34/h5-14,19,24-25H,3-4,15,35H2,1-2H3/t19-,24-,25-/m1/s1 |
| InChIKey | ZIRGECIWPQAGCC-UKDVSSAZSA-N |
| XLogP | 6.21 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.08 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|