C31H29N3O7S — CID 4920204
diethyl 2-amino-4-(3-nitrophenyl)-5-oxo-1-phenyl-7-thiophen-2-yl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate (PubChem CID 4920204) has the molecular formula C31H29N3O7S and a molecular weight of 587.65 g/mol. Its IUPAC name is diethyl 2-amino-4-(3-nitrophenyl)-5-oxo-1-phenyl-7-thiophen-2-yl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate.
| Compound Name | diethyl 2-amino-4-(3-nitrophenyl)-5-oxo-1-phenyl-7-thiophen-2-yl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 4920204 |
| Molecular Formula | C31H29N3O7S |
| Molecular Weight | 587.65 g/mol |
| Exact Mass | 587.17 |
| IUPAC Name | diethyl 2-amino-4-(3-nitrophenyl)-5-oxo-1-phenyl-7-thiophen-2-yl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
| SMILES | CCOC(=O)C1=C(N)N(c2ccccc2)C2=C(C(=O)C(C(=O)OCC)C(c3cccs3)C2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H29N3O7S/c1-3-40-30(36)25-21(23-14-9-15-42-23)17-22-26(28(25)35)24(18-10-8-13-20(16-18)34(38)39)27(31(37)41-4-2)29(32)33(22)19-11-6-5-7-12-19/h5-16,21,24-25H,3-4,17,32H2,1-2H3 |
| InChIKey | JZHBJZKDLVMSEK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 142.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.65 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|