C31H30N4O7S — CID 100887590
diethyl (4R,6R,7S)-2-amino-1-(2-methyl-5-nitrophenyl)-5-oxo-4-pyridin-3-yl-7-thiophen-2-yl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate (PubChem CID 100887590) has the molecular formula C31H30N4O7S and a molecular weight of 602.67 g/mol. Its IUPAC name is diethyl (4R,6R,7S)-2-amino-1-(2-methyl-5-nitrophenyl)-5-oxo-4-pyridin-3-yl-7-thiophen-2-yl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate.
| Compound Name | diethyl (4R,6R,7S)-2-amino-1-(2-methyl-5-nitrophenyl)-5-oxo-4-pyridin-3-yl-7-thiophen-2-yl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 100887590 |
| Molecular Formula | C31H30N4O7S |
| Molecular Weight | 602.67 g/mol |
| Exact Mass | 602.18 |
| IUPAC Name | diethyl (4R,6R,7S)-2-amino-1-(2-methyl-5-nitrophenyl)-5-oxo-4-pyridin-3-yl-7-thiophen-2-yl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
| SMILES | CCOC(=O)C1=C(N)N(c2cc([N+](=O)[O-])ccc2C)C2=C(C(=O)[C@H](C(=O)OCC)[C@@H](c3cccs3)C2)[C@H]1c1cccnc1 |
| InChI | InChI=1S/C31H30N4O7S/c1-4-41-30(37)25-20(23-9-7-13-43-23)15-22-26(28(25)36)24(18-8-6-12-33-16-18)27(31(38)42-5-2)29(32)34(22)21-14-19(35(39)40)11-10-17(21)3/h6-14,16,20,24-25H,4-5,15,32H2,1-3H3/t20-,24-,25-/m1/s1 |
| InChIKey | KMDBGTVUTBBXCC-NIJXNBFTSA-N |
| XLogP | 4.89 |
| TPSA | 154.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.67 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|