C33H33N3O6 — CID 98064564
diethyl (4S,6R,7R)-2-amino-7-(3-methoxyphenyl)-5-oxo-1-phenyl-4-pyridin-3-yl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate (PubChem CID 98064564) has the molecular formula C33H33N3O6 and a molecular weight of 567.64 g/mol. Its IUPAC name is diethyl (4S,6R,7R)-2-amino-7-(3-methoxyphenyl)-5-oxo-1-phenyl-4-pyridin-3-yl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate.
| Compound Name | diethyl (4S,6R,7R)-2-amino-7-(3-methoxyphenyl)-5-oxo-1-phenyl-4-pyridin-3-yl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 98064564 |
| Molecular Formula | C33H33N3O6 |
| Molecular Weight | 567.64 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | diethyl (4S,6R,7R)-2-amino-7-(3-methoxyphenyl)-5-oxo-1-phenyl-4-pyridin-3-yl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
| SMILES | CCOC(=O)C1=C(N)N(c2ccccc2)C2=C(C(=O)[C@H](C(=O)OCC)[C@H](c3cccc(OC)c3)C2)[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C33H33N3O6/c1-4-41-32(38)27-24(20-11-9-15-23(17-20)40-3)18-25-28(30(27)37)26(21-12-10-16-35-19-21)29(33(39)42-5-2)31(34)36(25)22-13-7-6-8-14-22/h6-17,19,24,26-27H,4-5,18,34H2,1-3H3/t24-,26-,27+/m0/s1 |
| InChIKey | XIPFZPFUHVEWEL-DOEKTCAHSA-N |
| XLogP | 4.62 |
| TPSA | 121.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.64 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|