C30H26FN3O5 — CID 98398954
dimethyl (4R,6R,7R)-2-amino-1-(4-fluorophenyl)-5-oxo-7-phenyl-4-pyridin-3-yl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate (PubChem CID 98398954) has the molecular formula C30H26FN3O5 and a molecular weight of 527.55 g/mol. Its IUPAC name is dimethyl (4R,6R,7R)-2-amino-1-(4-fluorophenyl)-5-oxo-7-phenyl-4-pyridin-3-yl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate.
| Compound Name | dimethyl (4R,6R,7R)-2-amino-1-(4-fluorophenyl)-5-oxo-7-phenyl-4-pyridin-3-yl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 98398954 |
| Molecular Formula | C30H26FN3O5 |
| Molecular Weight | 527.55 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | dimethyl (4R,6R,7R)-2-amino-1-(4-fluorophenyl)-5-oxo-7-phenyl-4-pyridin-3-yl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
| SMILES | COC(=O)C1=C(N)N(c2ccc(F)cc2)C2=C(C(=O)[C@H](C(=O)OC)[C@H](c3ccccc3)C2)[C@H]1c1cccnc1 |
| InChI | InChI=1S/C30H26FN3O5/c1-38-29(36)24-21(17-7-4-3-5-8-17)15-22-25(27(24)35)23(18-9-6-14-33-16-18)26(30(37)39-2)28(32)34(22)20-12-10-19(31)11-13-20/h3-14,16,21,23-24H,15,32H2,1-2H3/t21-,23+,24+/m0/s1 |
| InChIKey | PBJHFGIUVIGZED-QPTUXGOLSA-N |
| XLogP | 3.97 |
| TPSA | 111.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|