C33H30F3N3O5 — CID 98064693
diethyl (4S,6R,7R)-2-amino-5-oxo-7-phenyl-4-pyridin-3-yl-1-[4-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate (PubChem CID 98064693) has the molecular formula C33H30F3N3O5 and a molecular weight of 605.61 g/mol. Its IUPAC name is diethyl (4S,6R,7R)-2-amino-5-oxo-7-phenyl-4-pyridin-3-yl-1-[4-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate.
| Compound Name | diethyl (4S,6R,7R)-2-amino-5-oxo-7-phenyl-4-pyridin-3-yl-1-[4-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 98064693 |
| Molecular Formula | C33H30F3N3O5 |
| Molecular Weight | 605.61 g/mol |
| Exact Mass | 605.21 |
| IUPAC Name | diethyl (4S,6R,7R)-2-amino-5-oxo-7-phenyl-4-pyridin-3-yl-1-[4-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
| SMILES | CCOC(=O)C1=C(N)N(c2ccc(C(F)(F)F)cc2)C2=C(C(=O)[C@H](C(=O)OCC)[C@H](c3ccccc3)C2)[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C33H30F3N3O5/c1-3-43-31(41)26-23(19-9-6-5-7-10-19)17-24-27(29(26)40)25(20-11-8-16-38-18-20)28(32(42)44-4-2)30(37)39(24)22-14-12-21(13-15-22)33(34,35)36/h5-16,18,23,25-26H,3-4,17,37H2,1-2H3/t23-,25-,26+/m0/s1 |
| InChIKey | JJFWISUYQXZGBM-AYRHNUGRSA-N |
| XLogP | 5.63 |
| TPSA | 111.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.61 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|