C30H25F3N2O5S — CID 98069272
dimethyl (4S,6S,7R)-2-amino-5-oxo-7-phenyl-4-thiophen-2-yl-1-[4-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate (PubChem CID 98069272) has the molecular formula C30H25F3N2O5S and a molecular weight of 582.60 g/mol. Its IUPAC name is dimethyl (4S,6S,7R)-2-amino-5-oxo-7-phenyl-4-thiophen-2-yl-1-[4-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate.
| Compound Name | dimethyl (4S,6S,7R)-2-amino-5-oxo-7-phenyl-4-thiophen-2-yl-1-[4-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 98069272 |
| Molecular Formula | C30H25F3N2O5S |
| Molecular Weight | 582.60 g/mol |
| Exact Mass | 582.14 |
| IUPAC Name | dimethyl (4S,6S,7R)-2-amino-5-oxo-7-phenyl-4-thiophen-2-yl-1-[4-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
| SMILES | COC(=O)C1=C(N)N(c2ccc(C(F)(F)F)cc2)C2=C(C(=O)[C@@H](C(=O)OC)[C@H](c3ccccc3)C2)[C@@H]1c1cccs1 |
| InChI | InChI=1S/C30H25F3N2O5S/c1-39-28(37)22-19(16-7-4-3-5-8-16)15-20-23(26(22)36)24(21-9-6-14-41-21)25(29(38)40-2)27(34)35(20)18-12-10-17(11-13-18)30(31,32)33/h3-14,19,22,24H,15,34H2,1-2H3/t19-,22-,24-/m0/s1 |
| InChIKey | SUPOTKFPUMDACT-APTRMMRNSA-N |
| XLogP | 5.51 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.60 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|