C32H26ClF3N2O5 — CID 98066245
dimethyl (4S,6R,7R)-2-amino-4-(3-chlorophenyl)-5-oxo-7-phenyl-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate (PubChem CID 98066245) has the molecular formula C32H26ClF3N2O5 and a molecular weight of 611.02 g/mol. Its IUPAC name is dimethyl (4S,6R,7R)-2-amino-4-(3-chlorophenyl)-5-oxo-7-phenyl-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate.
| Compound Name | dimethyl (4S,6R,7R)-2-amino-4-(3-chlorophenyl)-5-oxo-7-phenyl-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 98066245 |
| Molecular Formula | C32H26ClF3N2O5 |
| Molecular Weight | 611.02 g/mol |
| Exact Mass | 610.15 |
| IUPAC Name | dimethyl (4S,6R,7R)-2-amino-4-(3-chlorophenyl)-5-oxo-7-phenyl-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
| SMILES | COC(=O)C1=C(N)N(c2cccc(C(F)(F)F)c2)C2=C(C(=O)[C@H](C(=O)OC)[C@H](c3ccccc3)C2)[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C32H26ClF3N2O5/c1-42-30(40)25-22(17-8-4-3-5-9-17)16-23-26(28(25)39)24(18-10-6-12-20(33)14-18)27(31(41)43-2)29(37)38(23)21-13-7-11-19(15-21)32(34,35)36/h3-15,22,24-25H,16,37H2,1-2H3/t22-,24-,25+/m0/s1 |
| InChIKey | OGKHAUAODJUHJU-ZKMPZPQNSA-N |
| XLogP | 6.11 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.02 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|