C32H29ClN2O6 — CID 98065858
dimethyl (4R,6R,7R)-2-amino-4-(3-chlorophenyl)-7-(4-methoxyphenyl)-5-oxo-1-phenyl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate (PubChem CID 98065858) has the molecular formula C32H29ClN2O6 and a molecular weight of 573.05 g/mol. Its IUPAC name is dimethyl (4R,6R,7R)-2-amino-4-(3-chlorophenyl)-7-(4-methoxyphenyl)-5-oxo-1-phenyl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate.
| Compound Name | dimethyl (4R,6R,7R)-2-amino-4-(3-chlorophenyl)-7-(4-methoxyphenyl)-5-oxo-1-phenyl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 98065858 |
| Molecular Formula | C32H29ClN2O6 |
| Molecular Weight | 573.05 g/mol |
| Exact Mass | 572.17 |
| IUPAC Name | dimethyl (4R,6R,7R)-2-amino-4-(3-chlorophenyl)-7-(4-methoxyphenyl)-5-oxo-1-phenyl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
| SMILES | COC(=O)C1=C(N)N(c2ccccc2)C2=C(C(=O)[C@H](C(=O)OC)[C@H](c3ccc(OC)cc3)C2)[C@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C32H29ClN2O6/c1-39-22-14-12-18(13-15-22)23-17-24-27(29(36)26(23)31(37)40-2)25(19-8-7-9-20(33)16-19)28(32(38)41-3)30(34)35(24)21-10-5-4-6-11-21/h4-16,23,25-26H,17,34H2,1-3H3/t23-,25+,26+/m0/s1 |
| InChIKey | YNDRVXLKMGWFCX-SKBVVQJISA-N |
| XLogP | 5.10 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.05 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|