C31H27FN2O5 — CID 51708475
dimethyl (4S,6R,7R)-2-amino-4-(4-fluorophenyl)-5-oxo-1,7-diphenyl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate (PubChem CID 51708475) has the molecular formula C31H27FN2O5 and a molecular weight of 526.56 g/mol. Its IUPAC name is dimethyl (4S,6R,7R)-2-amino-4-(4-fluorophenyl)-5-oxo-1,7-diphenyl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate.
| Compound Name | dimethyl (4S,6R,7R)-2-amino-4-(4-fluorophenyl)-5-oxo-1,7-diphenyl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 51708475 |
| Molecular Formula | C31H27FN2O5 |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | dimethyl (4S,6R,7R)-2-amino-4-(4-fluorophenyl)-5-oxo-1,7-diphenyl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
| SMILES | COC(=O)C1=C(N)N(c2ccccc2)C2=C(C(=O)[C@H](C(=O)OC)[C@H](c3ccccc3)C2)[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C31H27FN2O5/c1-38-30(36)25-22(18-9-5-3-6-10-18)17-23-26(28(25)35)24(19-13-15-20(32)16-14-19)27(31(37)39-2)29(33)34(23)21-11-7-4-8-12-21/h3-16,22,24-25H,17,33H2,1-2H3/t22-,24-,25+/m0/s1 |
| InChIKey | MOQVADOVDSQPPX-ZKMPZPQNSA-N |
| XLogP | 4.57 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|