C31H26F2N2O5 — CID 4916382
dimethyl 2-amino-1,4-bis(2-fluorophenyl)-5-oxo-7-phenyl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate (PubChem CID 4916382) has the molecular formula C31H26F2N2O5 and a molecular weight of 544.55 g/mol. Its IUPAC name is dimethyl 2-amino-1,4-bis(2-fluorophenyl)-5-oxo-7-phenyl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate.
| Compound Name | dimethyl 2-amino-1,4-bis(2-fluorophenyl)-5-oxo-7-phenyl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 4916382 |
| Molecular Formula | C31H26F2N2O5 |
| Molecular Weight | 544.55 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | dimethyl 2-amino-1,4-bis(2-fluorophenyl)-5-oxo-7-phenyl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
| SMILES | COC(=O)C1=C(N)N(c2ccccc2F)C2=C(C(=O)C(C(=O)OC)C(c3ccccc3)C2)C1c1ccccc1F |
| InChI | InChI=1S/C31H26F2N2O5/c1-39-30(37)25-19(17-10-4-3-5-11-17)16-23-26(28(25)36)24(18-12-6-7-13-20(18)32)27(31(38)40-2)29(34)35(23)22-15-9-8-14-21(22)33/h3-15,19,24-25H,16,34H2,1-2H3 |
| InChIKey | CDGATFOVDDZBPE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.55 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|