C29H25FN2O5S — CID 98069205
dimethyl (4S,6S,7R)-2-amino-1-(2-fluorophenyl)-5-oxo-7-phenyl-4-thiophen-2-yl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate (PubChem CID 98069205) has the molecular formula C29H25FN2O5S and a molecular weight of 532.59 g/mol. Its IUPAC name is dimethyl (4S,6S,7R)-2-amino-1-(2-fluorophenyl)-5-oxo-7-phenyl-4-thiophen-2-yl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate.
| Compound Name | dimethyl (4S,6S,7R)-2-amino-1-(2-fluorophenyl)-5-oxo-7-phenyl-4-thiophen-2-yl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 98069205 |
| Molecular Formula | C29H25FN2O5S |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | dimethyl (4S,6S,7R)-2-amino-1-(2-fluorophenyl)-5-oxo-7-phenyl-4-thiophen-2-yl-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
| SMILES | COC(=O)C1=C(N)N(c2ccccc2F)C2=C(C(=O)[C@@H](C(=O)OC)[C@H](c3ccccc3)C2)[C@@H]1c1cccs1 |
| InChI | InChI=1S/C29H25FN2O5S/c1-36-28(34)22-17(16-9-4-3-5-10-16)15-20-23(26(22)33)24(21-13-8-14-38-21)25(29(35)37-2)27(31)32(20)19-12-7-6-11-18(19)30/h3-14,17,22,24H,15,31H2,1-2H3/t17-,22-,24-/m0/s1 |
| InChIKey | CYAOFIASOHSVFH-OWSXEPHWSA-N |
| XLogP | 4.63 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|