C31H26F3N3O5 — CID 98064625
dimethyl (4S,6S,7R)-2-amino-5-oxo-7-phenyl-4-pyridin-3-yl-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate (PubChem CID 98064625) has the molecular formula C31H26F3N3O5 and a molecular weight of 577.56 g/mol. Its IUPAC name is dimethyl (4S,6S,7R)-2-amino-5-oxo-7-phenyl-4-pyridin-3-yl-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate.
| Compound Name | dimethyl (4S,6S,7R)-2-amino-5-oxo-7-phenyl-4-pyridin-3-yl-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 98064625 |
| Molecular Formula | C31H26F3N3O5 |
| Molecular Weight | 577.56 g/mol |
| Exact Mass | 577.18 |
| IUPAC Name | dimethyl (4S,6S,7R)-2-amino-5-oxo-7-phenyl-4-pyridin-3-yl-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
| SMILES | COC(=O)C1=C(N)N(c2cccc(C(F)(F)F)c2)C2=C(C(=O)[C@@H](C(=O)OC)[C@H](c3ccccc3)C2)[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C31H26F3N3O5/c1-41-29(39)24-21(17-8-4-3-5-9-17)15-22-25(27(24)38)23(18-10-7-13-36-16-18)26(30(40)42-2)28(35)37(22)20-12-6-11-19(14-20)31(32,33)34/h3-14,16,21,23-24H,15,35H2,1-2H3/t21-,23-,24-/m0/s1 |
| InChIKey | CNVPDKUXRXYBOZ-XWGVYQGASA-N |
| XLogP | 4.85 |
| TPSA | 111.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.56 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|