C18H20N2O — CID 100894597
(3R,4R)-1-methyl-N,4-diphenylpyrrolidine-3-carboxamide (PubChem CID 100894597) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is (3R,4R)-1-methyl-N,4-diphenylpyrrolidine-3-carboxamide.
| Compound Name | (3R,4R)-1-methyl-N,4-diphenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 100894597 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | (3R,4R)-1-methyl-N,4-diphenylpyrrolidine-3-carboxamide |
| SMILES | CN1C[C@H](C(=O)Nc2ccccc2)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C18H20N2O/c1-20-12-16(14-8-4-2-5-9-14)17(13-20)18(21)19-15-10-6-3-7-11-15/h2-11,16-17H,12-13H2,1H3,(H,19,21)/t16-,17-/m0/s1 |
| InChIKey | ZUTKUMRHLZENHR-IRXDYDNUSA-N |
| XLogP | 2.97 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |