C23H26N2O — CID 23650808
(8R)-2-methyl-N,5-diphenyl-3,4,6,7,8,8a-hexahydro-1H-isoquinoline-8-carboxamide (PubChem CID 23650808) has the molecular formula C23H26N2O and a molecular weight of 346.47 g/mol. Its IUPAC name is (8R)-2-methyl-N,5-diphenyl-3,4,6,7,8,8a-hexahydro-1H-isoquinoline-8-carboxamide.
| Compound Name | (8R)-2-methyl-N,5-diphenyl-3,4,6,7,8,8a-hexahydro-1H-isoquinoline-8-carboxamide |
|---|---|
| PubChem CID | 23650808 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | (8R)-2-methyl-N,5-diphenyl-3,4,6,7,8,8a-hexahydro-1H-isoquinoline-8-carboxamide |
| SMILES | CN1CCC2=C(c3ccccc3)CC[C@@H](C(=O)Nc3ccccc3)C2C1 |
| InChI | InChI=1S/C23H26N2O/c1-25-15-14-20-19(17-8-4-2-5-9-17)12-13-21(22(20)16-25)23(26)24-18-10-6-3-7-11-18/h2-11,21-22H,12-16H2,1H3,(H,24,26)/t21-,22?/m1/s1 |
| InChIKey | FCRGZXGRNXWONJ-ZMFCMNQTSA-N |
| XLogP | 4.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |