C42H33NO3 — CID 100897530
(1S,9S,17S)-4,12,20-tribenzyl-8,16,24-trioxa-25-azahexacyclo[15.7.1.02,7.09,25.010,15.018,23]pentacosa-2(7),3,5,10(15),11,13,18(23),19,21-nonaene (PubChem CID 100897530) has the molecular formula C42H33NO3 and a molecular weight of 599.73 g/mol. Its IUPAC name is (1S,9S,17S)-4,12,20-tribenzyl-8,16,24-trioxa-25-azahexacyclo[15.7.1.02,7.09,25.010,15.018,23]pentacosa-2(7),3,5,10(15),11,13,18(23),19,21-nonaene.
| Compound Name | (1S,9S,17S)-4,12,20-tribenzyl-8,16,24-trioxa-25-azahexacyclo[15.7.1.02,7.09,25.010,15.018,23]pentacosa-2(7),3,5,10(15),11,13,18(23),19,21-nonaene |
|---|---|
| PubChem CID | 100897530 |
| Molecular Formula | C42H33NO3 |
| Molecular Weight | 599.73 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | (1S,9S,17S)-4,12,20-tribenzyl-8,16,24-trioxa-25-azahexacyclo[15.7.1.02,7.09,25.010,15.018,23]pentacosa-2(7),3,5,10(15),11,13,18(23),19,21-nonaene |
| SMILES | c1ccc(Cc2ccc3c(c2)[C@@H]2Oc4ccc(Cc5ccccc5)cc4[C@@H]4Oc5ccc(Cc6ccccc6)cc5[C@H](O3)N24)cc1 |
| InChI | InChI=1S/C42H33NO3/c1-4-10-28(11-5-1)22-31-16-19-37-34(25-31)40-43-41(44-37)36-27-33(24-30-14-8-3-9-15-30)18-21-39(36)46-42(43)35-26-32(17-20-38(35)45-40)23-29-12-6-2-7-13-29/h1-21,25-27,40-42H,22-24H2/t40-,41-,42-/m0/s1 |
| InChIKey | WQAIEGUEVYTKDH-BJKOEGOMSA-N |
| XLogP | 9.33 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.73 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |