About [(3R)-1-[(1S)-1-(2,4-difluorophenyl)propyl]piperidin-3-yl]methanesulfonamide
[(3R)-1-[(1S)-1-(2,4-difluorophenyl)propyl]piperidin-3-yl]methanesulfonamide (PubChem CID 100898380) has the molecular formula C15H22F2N2O2S
and a molecular weight of 332.42 g/mol. Its IUPAC name is [(3R)-1-[(1S)-1-(2,4-difluorophenyl)propyl]piperidin-3-yl]methanesulfonamide.
Molecular Properties
| Compound Name | [(3R)-1-[(1S)-1-(2,4-difluorophenyl)propyl]piperidin-3-yl]methanesulfonamide |
| PubChem CID | 100898380 |
| Molecular Formula | C15H22F2N2O2S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | [(3R)-1-[(1S)-1-(2,4-difluorophenyl)propyl]piperidin-3-yl]methanesulfonamide |
| SMILES | CC[C@@H](c1ccc(F)cc1F)N1CCC[C@@H](CS(N)(=O)=O)C1 |
| InChI | InChI=1S/C15H22F2N2O2S/c1-2-15(13-6-5-12(16)8-14(13)17)19-7-3-4-11(9-19)10-22(18,20)21/h5-6,8,11,15H,2-4,7,9-10H2,1H3,(H2,18,20,21)/t11-,15+/m1/s1 |
| InChIKey | AVCQCIUFVLJWOB-ABAIWWIYSA-N |
| XLogP | 2.42 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3R)-1-[(1S)-1-(2,4-difluorophenyl)propyl]piperidin-3-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-1-[(1S)-1-(2,4-difluorophenyl)propyl]piperidin-3-yl]methanesulfonamide?
The IUPAC name of [(3R)-1-[(1S)-1-(2,4-difluorophenyl)propyl]piperidin-3-yl]methanesulfonamide (CID 100898380) is [(3R)-1-[(1S)-1-(2,4-difluorophenyl)propyl]piperidin-3-yl]methanesulfonamide.
What is the SMILES notation for [(3R)-1-[(1S)-1-(2,4-difluorophenyl)propyl]piperidin-3-yl]methanesulfonamide?
The canonical SMILES for [(3R)-1-[(1S)-1-(2,4-difluorophenyl)propyl]piperidin-3-yl]methanesulfonamide is CC[C@@H](c1ccc(F)cc1F)N1CCC[C@@H](CS(N)(=O)=O)C1.
What is the InChIKey of [(3R)-1-[(1S)-1-(2,4-difluorophenyl)propyl]piperidin-3-yl]methanesulfonamide?
The InChIKey is AVCQCIUFVLJWOB-ABAIWWIYSA-N. The full InChI is InChI=1S/C15H22F2N2O2S/c1-2-15(13-6-5-12(16)8-14(13)17)19-7-3-4-11(9-19)10-22(18,20)21/h5-6,8,11,15H,2-4,7,9-10H2,1H3,(H2,18,20,21)/t11-,15+/m1/s1.
What are the key properties of [(3R)-1-[(1S)-1-(2,4-difluorophenyl)propyl]piperidin-3-yl]methanesulfonamide?
[(3R)-1-[(1S)-1-(2,4-difluorophenyl)propyl]piperidin-3-yl]methanesulfonamide has a molecular weight of 332.42 g/mol, XLogP of 2.42, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-1-[(1S)-1-(2,4-difluorophenyl)propyl]piperidin-3-yl]methanesulfonamide is sourced from PubChem (CID 100898380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).