C19H24O5S — CID 10090187
dimethyl 2-[2-(benzenesulfinyl)-2-(cyclohexen-1-yl)ethyl]propanedioate (PubChem CID 10090187) has the molecular formula C19H24O5S and a molecular weight of 364.46 g/mol. Its IUPAC name is dimethyl 2-[2-(benzenesulfinyl)-2-(cyclohexen-1-yl)ethyl]propanedioate.
| Compound Name | dimethyl 2-[2-(benzenesulfinyl)-2-(cyclohexen-1-yl)ethyl]propanedioate |
|---|---|
| PubChem CID | 10090187 |
| Molecular Formula | C19H24O5S |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | dimethyl 2-[2-(benzenesulfinyl)-2-(cyclohexen-1-yl)ethyl]propanedioate |
| SMILES | COC(=O)C(CC(C1=CCCCC1)S(=O)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C19H24O5S/c1-23-18(20)16(19(21)24-2)13-17(14-9-5-3-6-10-14)25(22)15-11-7-4-8-12-15/h4,7-9,11-12,16-17H,3,5-6,10,13H2,1-2H3 |
| InChIKey | JCCFHLMAGLGJKS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|