C16H22O2Si — CID 177487934
methyl (2R)-2-(cyclopenten-1-yl)-2-[dimethyl(phenyl)silyl]acetate (PubChem CID 177487934) has the molecular formula C16H22O2Si and a molecular weight of 274.44 g/mol. Its IUPAC name is methyl (2R)-2-(cyclopenten-1-yl)-2-[dimethyl(phenyl)silyl]acetate.
| Compound Name | methyl (2R)-2-(cyclopenten-1-yl)-2-[dimethyl(phenyl)silyl]acetate |
|---|---|
| PubChem CID | 177487934 |
| Molecular Formula | C16H22O2Si |
| Molecular Weight | 274.44 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | methyl (2R)-2-(cyclopenten-1-yl)-2-[dimethyl(phenyl)silyl]acetate |
| SMILES | COC(=O)[C@@H](C1=CCCC1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C16H22O2Si/c1-18-16(17)15(13-9-7-8-10-13)19(2,3)14-11-5-4-6-12-14/h4-6,9,11-12,15H,7-8,10H2,1-3H3/t15-/m1/s1 |
| InChIKey | WGHMAJKOSGYOOW-OAHLLOKOSA-N |
| XLogP | 3.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|