C22H23N3O4 — CID 100904417
2-[[2-[(3aS,7aS)-7-oxo-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrol-1-yl]acetyl]amino]-N-phenylbenzamide (PubChem CID 100904417) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-[[2-[(3aS,7aS)-7-oxo-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrol-1-yl]acetyl]amino]-N-phenylbenzamide.
| Compound Name | 2-[[2-[(3aS,7aS)-7-oxo-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrol-1-yl]acetyl]amino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 100904417 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 2-[[2-[(3aS,7aS)-7-oxo-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrol-1-yl]acetyl]amino]-N-phenylbenzamide |
| SMILES | O=C(CN1CC[C@H]2CCOC(=O)[C@H]21)Nc1ccccc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H23N3O4/c26-19(14-25-12-10-15-11-13-29-22(28)20(15)25)24-18-9-5-4-8-17(18)21(27)23-16-6-2-1-3-7-16/h1-9,15,20H,10-14H2,(H,23,27)(H,24,26)/t15-,20-/m0/s1 |
| InChIKey | PZCMPPNSIRKJQT-YWZLYKJASA-N |
| XLogP | 2.51 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |