C21H27N3O4 — CID 100904411
2-[[2-[(3aR,7aS)-7-oxo-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrol-1-yl]acetyl]amino]-N-cyclopentylbenzamide (PubChem CID 100904411) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 2-[[2-[(3aR,7aS)-7-oxo-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrol-1-yl]acetyl]amino]-N-cyclopentylbenzamide.
| Compound Name | 2-[[2-[(3aR,7aS)-7-oxo-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrol-1-yl]acetyl]amino]-N-cyclopentylbenzamide |
|---|---|
| PubChem CID | 100904411 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 2-[[2-[(3aR,7aS)-7-oxo-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrol-1-yl]acetyl]amino]-N-cyclopentylbenzamide |
| SMILES | O=C(CN1CC[C@@H]2CCOC(=O)[C@H]21)Nc1ccccc1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C21H27N3O4/c25-18(13-24-11-9-14-10-12-28-21(27)19(14)24)23-17-8-4-3-7-16(17)20(26)22-15-5-1-2-6-15/h3-4,7-8,14-15,19H,1-2,5-6,9-13H2,(H,22,26)(H,23,25)/t14-,19+/m1/s1 |
| InChIKey | NMZJOGAGWIUSQQ-KUHUBIRLSA-N |
| XLogP | 1.93 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |