C18H28O8 — CID 10090659
methyl (3aS,6aR,10R,10aS)-3-hydroxy-10-(2-methoxyethoxymethoxy)-5-oxo-3a,4,6,6a,7,8,9,10-octahydro-1H-benzo[d][2]benzofuran-3-carboxylate (PubChem CID 10090659) has the molecular formula C18H28O8 and a molecular weight of 372.41 g/mol. Its IUPAC name is methyl (3aS,6aR,10R,10aS)-3-hydroxy-10-(2-methoxyethoxymethoxy)-5-oxo-3a,4,6,6a,7,8,9,10-octahydro-1H-benzo[d][2]benzofuran-3-carboxylate.
| Compound Name | methyl (3aS,6aR,10R,10aS)-3-hydroxy-10-(2-methoxyethoxymethoxy)-5-oxo-3a,4,6,6a,7,8,9,10-octahydro-1H-benzo[d][2]benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 10090659 |
| Molecular Formula | C18H28O8 |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | methyl (3aS,6aR,10R,10aS)-3-hydroxy-10-(2-methoxyethoxymethoxy)-5-oxo-3a,4,6,6a,7,8,9,10-octahydro-1H-benzo[d][2]benzofuran-3-carboxylate |
| SMILES | COCCOCO[C@@H]1CCC[C@@H]2CC(=O)C[C@@H]3C(O)(C(=O)OC)OC[C@]231 |
| InChI | InChI=1S/C18H28O8/c1-22-6-7-24-11-25-15-5-3-4-12-8-13(19)9-14-17(12,15)10-26-18(14,21)16(20)23-2/h12,14-15,21H,3-11H2,1-2H3/t12-,14+,15-,17+,18?/m1/s1 |
| InChIKey | HJHRBYPWOGBDSR-ZAKBQIJNSA-N |
| XLogP | 0.65 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|