C18H12F3N3OS — CID 10090852
4-(2,4-difluorophenyl)-6-(4-fluoroanilino)-2-methylsulfanylpyrimidine-5-carbaldehyde (PubChem CID 10090852) has the molecular formula C18H12F3N3OS and a molecular weight of 375.38 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-6-(4-fluoroanilino)-2-methylsulfanylpyrimidine-5-carbaldehyde.
| Compound Name | 4-(2,4-difluorophenyl)-6-(4-fluoroanilino)-2-methylsulfanylpyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 10090852 |
| Molecular Formula | C18H12F3N3OS |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 4-(2,4-difluorophenyl)-6-(4-fluoroanilino)-2-methylsulfanylpyrimidine-5-carbaldehyde |
| SMILES | CSc1nc(Nc2ccc(F)cc2)c(C=O)c(-c2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C18H12F3N3OS/c1-26-18-23-16(13-7-4-11(20)8-15(13)21)14(9-25)17(24-18)22-12-5-2-10(19)3-6-12/h2-9H,1H3,(H,22,23,24) |
| InChIKey | MMQJPIULOQFIMJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|