C12H10ClN5S — CID 25168541
N-(4-chlorophenyl)-2-methylsulfanyl-7H-purin-6-amine (PubChem CID 25168541) has the molecular formula C12H10ClN5S and a molecular weight of 291.77 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-methylsulfanyl-7H-purin-6-amine.
| Compound Name | N-(4-chlorophenyl)-2-methylsulfanyl-7H-purin-6-amine |
|---|---|
| PubChem CID | 25168541 |
| Molecular Formula | C12H10ClN5S |
| Molecular Weight | 291.77 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | N-(4-chlorophenyl)-2-methylsulfanyl-7H-purin-6-amine |
| SMILES | CSc1nc(Nc2ccc(Cl)cc2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C12H10ClN5S/c1-19-12-17-10-9(14-6-15-10)11(18-12)16-8-4-2-7(13)3-5-8/h2-6H,1H3,(H2,14,15,16,17,18) |
| InChIKey | NMRYCOVOIPMBEZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.77 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |