C20H30N4O — CID 100909966
[(3R)-1-[6-[(6R)-2-azaspiro[5.5]undec-9-en-2-yl]pyrimidin-4-yl]piperidin-3-yl]methanol (PubChem CID 100909966) has the molecular formula C20H30N4O and a molecular weight of 342.49 g/mol. Its IUPAC name is [(3R)-1-[6-[(6R)-2-azaspiro[5.5]undec-9-en-2-yl]pyrimidin-4-yl]piperidin-3-yl]methanol.
| Compound Name | [(3R)-1-[6-[(6R)-2-azaspiro[5.5]undec-9-en-2-yl]pyrimidin-4-yl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 100909966 |
| Molecular Formula | C20H30N4O |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | [(3R)-1-[6-[(6R)-2-azaspiro[5.5]undec-9-en-2-yl]pyrimidin-4-yl]piperidin-3-yl]methanol |
| SMILES | OC[C@@H]1CCCN(c2cc(N3CCC[C@]4(CC=CCC4)C3)ncn2)C1 |
| InChI | InChI=1S/C20H30N4O/c25-14-17-6-4-10-23(13-17)18-12-19(22-16-21-18)24-11-5-9-20(15-24)7-2-1-3-8-20/h1-2,12,16-17,25H,3-11,13-15H2/t17-,20-/m1/s1 |
| InChIKey | ZBSVEZRWRSHKRM-YLJYHZDGSA-N |
| XLogP | 3.01 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|