C36H33BrO2S5 — CID 100915357
benzyl 5-[5-[5-[5-(5-bromothiophen-2-yl)thiophen-2-yl]-4-octylthiophen-2-yl]thiophen-2-yl]thiophene-2-carboxylate (PubChem CID 100915357) has the molecular formula C36H33BrO2S5 and a molecular weight of 737.90 g/mol. Its IUPAC name is benzyl 5-[5-[5-[5-(5-bromothiophen-2-yl)thiophen-2-yl]-4-octylthiophen-2-yl]thiophen-2-yl]thiophene-2-carboxylate.
| Compound Name | benzyl 5-[5-[5-[5-(5-bromothiophen-2-yl)thiophen-2-yl]-4-octylthiophen-2-yl]thiophen-2-yl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 100915357 |
| Molecular Formula | C36H33BrO2S5 |
| Molecular Weight | 737.90 g/mol |
| Exact Mass | 736.03 |
| IUPAC Name | benzyl 5-[5-[5-[5-(5-bromothiophen-2-yl)thiophen-2-yl]-4-octylthiophen-2-yl]thiophen-2-yl]thiophene-2-carboxylate |
| SMILES | CCCCCCCCc1cc(-c2ccc(-c3ccc(C(=O)OCc4ccccc4)s3)s2)sc1-c1ccc(-c2ccc(Br)s2)s1 |
| InChI | InChI=1S/C36H33BrO2S5/c1-2-3-4-5-6-10-13-25-22-33(44-35(25)31-18-16-28(41-31)29-20-21-34(37)43-29)30-15-14-26(40-30)27-17-19-32(42-27)36(38)39-23-24-11-8-7-9-12-24/h7-9,11-12,14-22H,2-6,10,13,23H2,1H3 |
| InChIKey | NDIPBJSHIHWGMN-UHFFFAOYSA-N |
| XLogP | 13.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.90 |
| LogP ≤ 5 | 13.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|