C28H35IO2S2 — CID 11387782
benzyl 3-hexyl-5-(3-hexyl-5-iodothiophen-2-yl)thiophene-2-carboxylate (PubChem CID 11387782) has the molecular formula C28H35IO2S2 and a molecular weight of 594.62 g/mol. Its IUPAC name is benzyl 3-hexyl-5-(3-hexyl-5-iodothiophen-2-yl)thiophene-2-carboxylate.
| Compound Name | benzyl 3-hexyl-5-(3-hexyl-5-iodothiophen-2-yl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 11387782 |
| Molecular Formula | C28H35IO2S2 |
| Molecular Weight | 594.62 g/mol |
| Exact Mass | 594.11 |
| IUPAC Name | benzyl 3-hexyl-5-(3-hexyl-5-iodothiophen-2-yl)thiophene-2-carboxylate |
| SMILES | CCCCCCc1cc(-c2sc(I)cc2CCCCCC)sc1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H35IO2S2/c1-3-5-7-12-16-22-18-24(26-23(19-25(29)33-26)17-13-8-6-4-2)32-27(22)28(30)31-20-21-14-10-9-11-15-21/h9-11,14-15,18-19H,3-8,12-13,16-17,20H2,1-2H3 |
| InChIKey | VAZSJAGOCXPPRT-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.62 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|