C53H56O2S7 — CID 101055827
benzyl 2-[2,5-bis[4-octyl-5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophen-3-yl]acetate (PubChem CID 101055827) has the molecular formula C53H56O2S7 and a molecular weight of 949.50 g/mol. Its IUPAC name is benzyl 2-[2,5-bis[4-octyl-5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophen-3-yl]acetate.
| Compound Name | benzyl 2-[2,5-bis[4-octyl-5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophen-3-yl]acetate |
|---|---|
| PubChem CID | 101055827 |
| Molecular Formula | C53H56O2S7 |
| Molecular Weight | 949.50 g/mol |
| Exact Mass | 948.23 |
| IUPAC Name | benzyl 2-[2,5-bis[4-octyl-5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophen-3-yl]acetate |
| SMILES | CCCCCCCCc1cc(-c2cc(CC(=O)OCc3ccccc3)c(-c3cc(CCCCCCCC)c(-c4ccc(-c5cccs5)s4)s3)s2)sc1-c1ccc(-c2cccs2)s1 |
| InChI | InChI=1S/C53H56O2S7/c1-3-5-7-9-11-16-22-38-32-47(60-51(38)45-28-26-43(58-45)41-24-18-30-56-41)48-34-40(35-50(54)55-36-37-20-14-13-15-21-37)53(61-48)49-33-39(23-17-12-10-8-6-4-2)52(62-49)46-29-27-44(59-46)42-25-19-31-57-42/h13-15,18-21,24-34H,3-12,16-17,22-23,35-36H2,1-2H3 |
| InChIKey | UADYUPVWWFCFJQ-UHFFFAOYSA-N |
| XLogP | 19.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.50 |
| LogP ≤ 5 | 19.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|