C23H31NO4S — CID 22053835
5-decyl-2-(phenylmethoxycarbonylamino)thiophene-3-carboxylic acid (PubChem CID 22053835) has the molecular formula C23H31NO4S and a molecular weight of 417.57 g/mol. Its IUPAC name is 5-decyl-2-(phenylmethoxycarbonylamino)thiophene-3-carboxylic acid.
| Compound Name | 5-decyl-2-(phenylmethoxycarbonylamino)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 22053835 |
| Molecular Formula | C23H31NO4S |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 5-decyl-2-(phenylmethoxycarbonylamino)thiophene-3-carboxylic acid |
| SMILES | CCCCCCCCCCc1cc(C(=O)O)c(NC(=O)OCc2ccccc2)s1 |
| InChI | InChI=1S/C23H31NO4S/c1-2-3-4-5-6-7-8-12-15-19-16-20(22(25)26)21(29-19)24-23(27)28-17-18-13-10-9-11-14-18/h9-11,13-14,16H,2-8,12,15,17H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | BNFGOMYIYVIMFN-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|