C24H33NO4S — CID 174477804
5-decyl-2-(N-ethoxycarbonylanilino)thiophene-3-carboxylic acid (PubChem CID 174477804) has the molecular formula C24H33NO4S and a molecular weight of 431.60 g/mol. Its IUPAC name is 5-decyl-2-(N-ethoxycarbonylanilino)thiophene-3-carboxylic acid.
| Compound Name | 5-decyl-2-(N-ethoxycarbonylanilino)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 174477804 |
| Molecular Formula | C24H33NO4S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 5-decyl-2-(N-ethoxycarbonylanilino)thiophene-3-carboxylic acid |
| SMILES | CCCCCCCCCCc1cc(C(=O)O)c(N(C(=O)OCC)c2ccccc2)s1 |
| InChI | InChI=1S/C24H33NO4S/c1-3-5-6-7-8-9-10-14-17-20-18-21(23(26)27)22(30-20)25(24(28)29-4-2)19-15-12-11-13-16-19/h11-13,15-16,18H,3-10,14,17H2,1-2H3,(H,26,27) |
| InChIKey | HUGBTTOIGOKHSR-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|