C27H39NO4S — CID 22053922
2-[(4-butylphenyl)methoxycarbonylamino]-5-decylthiophene-3-carboxylic acid (PubChem CID 22053922) has the molecular formula C27H39NO4S and a molecular weight of 473.68 g/mol. Its IUPAC name is 2-[(4-butylphenyl)methoxycarbonylamino]-5-decylthiophene-3-carboxylic acid.
| Compound Name | 2-[(4-butylphenyl)methoxycarbonylamino]-5-decylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 22053922 |
| Molecular Formula | C27H39NO4S |
| Molecular Weight | 473.68 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | 2-[(4-butylphenyl)methoxycarbonylamino]-5-decylthiophene-3-carboxylic acid |
| SMILES | CCCCCCCCCCc1cc(C(=O)O)c(NC(=O)OCc2ccc(CCCC)cc2)s1 |
| InChI | InChI=1S/C27H39NO4S/c1-3-5-7-8-9-10-11-12-14-23-19-24(26(29)30)25(33-23)28-27(31)32-20-22-17-15-21(16-18-22)13-6-4-2/h15-19H,3-14,20H2,1-2H3,(H,28,31)(H,29,30) |
| InChIKey | TZLLCZBHJIMUCS-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.68 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|