C16H32O3Si — CID 100916415
methyl 2,2-dimethyl-3-[(E)-2-trimethylsilyloxyethenyl]octanoate (PubChem CID 100916415) has the molecular formula C16H32O3Si and a molecular weight of 300.51 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-[(E)-2-trimethylsilyloxyethenyl]octanoate.
| Compound Name | methyl 2,2-dimethyl-3-[(E)-2-trimethylsilyloxyethenyl]octanoate |
|---|---|
| PubChem CID | 100916415 |
| Molecular Formula | C16H32O3Si |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | methyl 2,2-dimethyl-3-[(E)-2-trimethylsilyloxyethenyl]octanoate |
| SMILES | CCCCCC(/C=C/O[Si](C)(C)C)C(C)(C)C(=O)OC |
| InChI | InChI=1S/C16H32O3Si/c1-8-9-10-11-14(12-13-19-20(5,6)7)16(2,3)15(17)18-4/h12-14H,8-11H2,1-7H3/b13-12+ |
| InChIKey | XIAZPFNQGHWDQL-OUKQBFOZSA-N |
| XLogP | 4.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|