C18H32O3Si — CID 134844353
methyl (3S)-3-[(1R)-4,4-dimethyl-1-prop-2-enyl-2-trimethylsilyloxycyclopent-2-en-1-yl]butanoate (PubChem CID 134844353) has the molecular formula C18H32O3Si and a molecular weight of 324.54 g/mol. Its IUPAC name is methyl (3S)-3-[(1R)-4,4-dimethyl-1-prop-2-enyl-2-trimethylsilyloxycyclopent-2-en-1-yl]butanoate.
| Compound Name | methyl (3S)-3-[(1R)-4,4-dimethyl-1-prop-2-enyl-2-trimethylsilyloxycyclopent-2-en-1-yl]butanoate |
|---|---|
| PubChem CID | 134844353 |
| Molecular Formula | C18H32O3Si |
| Molecular Weight | 324.54 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | methyl (3S)-3-[(1R)-4,4-dimethyl-1-prop-2-enyl-2-trimethylsilyloxycyclopent-2-en-1-yl]butanoate |
| SMILES | C=CC[C@]1([C@@H](C)CC(=O)OC)CC(C)(C)C=C1O[Si](C)(C)C |
| InChI | InChI=1S/C18H32O3Si/c1-9-10-18(14(2)11-16(19)20-5)13-17(3,4)12-15(18)21-22(6,7)8/h9,12,14H,1,10-11,13H2,2-8H3/t14-,18+/m0/s1 |
| InChIKey | YHLRVGMLBIPUIQ-KBXCAEBGSA-N |
| XLogP | 4.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|