C29H54O3Si — CID 11386048
methyl 9-[2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-oct-1-enyl]cyclopenten-1-yl]nonanoate (PubChem CID 11386048) has the molecular formula C29H54O3Si and a molecular weight of 478.83 g/mol. Its IUPAC name is methyl 9-[2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-oct-1-enyl]cyclopenten-1-yl]nonanoate.
| Compound Name | methyl 9-[2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-oct-1-enyl]cyclopenten-1-yl]nonanoate |
|---|---|
| PubChem CID | 11386048 |
| Molecular Formula | C29H54O3Si |
| Molecular Weight | 478.83 g/mol |
| Exact Mass | 478.38 |
| IUPAC Name | methyl 9-[2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-oct-1-enyl]cyclopenten-1-yl]nonanoate |
| SMILES | CCCCCC/C=C/C1CCC(O[Si](C)(C)C(C)(C)C)=C1CCCCCCCCC(=O)OC |
| InChI | InChI=1S/C29H54O3Si/c1-8-9-10-11-14-17-20-25-23-24-27(32-33(6,7)29(2,3)4)26(25)21-18-15-12-13-16-19-22-28(30)31-5/h17,20,25H,8-16,18-19,21-24H2,1-7H3/b20-17+ |
| InChIKey | JAMUIIFIQKXSES-LVZFUZTISA-N |
| XLogP | 9.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.83 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|