C26H50O4Si — CID 11316996
1-O-[tert-butyl(dimethyl)silyl] 5-O-ethyl (2S,3S,4S)-3-[(E)-hept-1-enyl]-2-methyl-4-pentylpentanedioate (PubChem CID 11316996) has the molecular formula C26H50O4Si and a molecular weight of 454.77 g/mol. Its IUPAC name is 1-O-[tert-butyl(dimethyl)silyl] 5-O-ethyl (2S,3S,4S)-3-[(E)-hept-1-enyl]-2-methyl-4-pentylpentanedioate.
| Compound Name | 1-O-[tert-butyl(dimethyl)silyl] 5-O-ethyl (2S,3S,4S)-3-[(E)-hept-1-enyl]-2-methyl-4-pentylpentanedioate |
|---|---|
| PubChem CID | 11316996 |
| Molecular Formula | C26H50O4Si |
| Molecular Weight | 454.77 g/mol |
| Exact Mass | 454.35 |
| IUPAC Name | 1-O-[tert-butyl(dimethyl)silyl] 5-O-ethyl (2S,3S,4S)-3-[(E)-hept-1-enyl]-2-methyl-4-pentylpentanedioate |
| SMILES | CCCCC/C=C/[C@@H]([C@H](C)C(=O)O[Si](C)(C)C(C)(C)C)[C@H](CCCCC)C(=O)OCC |
| InChI | InChI=1S/C26H50O4Si/c1-10-13-15-16-18-19-22(23(20-17-14-11-2)25(28)29-12-3)21(4)24(27)30-31(8,9)26(5,6)7/h18-19,21-23H,10-17,20H2,1-9H3/b19-18+/t21-,22-,23-/m0/s1 |
| InChIKey | VOZNDARPTWYRDS-JHHDSSINSA-N |
| XLogP | 7.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.77 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|