C20H32O4 — CID 100916668
(3R,4aR,6aR,7R,8R,10aS,10bR)-3-ethenyl-8-hydroxy-7-(hydroxymethyl)-3,4a,7,10a-tetramethyl-2,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-1-one (PubChem CID 100916668) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (3R,4aR,6aR,7R,8R,10aS,10bR)-3-ethenyl-8-hydroxy-7-(hydroxymethyl)-3,4a,7,10a-tetramethyl-2,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-1-one.
| Compound Name | (3R,4aR,6aR,7R,8R,10aS,10bR)-3-ethenyl-8-hydroxy-7-(hydroxymethyl)-3,4a,7,10a-tetramethyl-2,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-1-one |
|---|---|
| PubChem CID | 100916668 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (3R,4aR,6aR,7R,8R,10aS,10bR)-3-ethenyl-8-hydroxy-7-(hydroxymethyl)-3,4a,7,10a-tetramethyl-2,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-1-one |
| SMILES | C=C[C@@]1(C)CC(=O)[C@@H]2[C@@]3(C)CC[C@@H](O)[C@@](C)(CO)[C@@H]3CC[C@@]2(C)O1 |
| InChI | InChI=1S/C20H32O4/c1-6-17(2)11-13(22)16-18(3)9-8-15(23)19(4,12-21)14(18)7-10-20(16,5)24-17/h6,14-16,21,23H,1,7-12H2,2-5H3/t14-,15-,16-,17+,18+,19+,20-/m1/s1 |
| InChIKey | SMYMMPKWVTWVFB-VSKDJGRCSA-N |
| XLogP | 2.87 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|