C30H48O5 — CID 75079488
8,19-dihydroxy-7,20-bis(hydroxymethyl)-1,7,11,16,20-pentamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-en-5-one (PubChem CID 75079488) has the molecular formula C30H48O5 and a molecular weight of 488.71 g/mol. Its IUPAC name is 8,19-dihydroxy-7,20-bis(hydroxymethyl)-1,7,11,16,20-pentamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-en-5-one.
| Compound Name | 8,19-dihydroxy-7,20-bis(hydroxymethyl)-1,7,11,16,20-pentamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-en-5-one |
|---|---|
| PubChem CID | 75079488 |
| Molecular Formula | C30H48O5 |
| Molecular Weight | 488.71 g/mol |
| Exact Mass | 488.35 |
| IUPAC Name | 8,19-dihydroxy-7,20-bis(hydroxymethyl)-1,7,11,16,20-pentamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-en-5-one |
| SMILES | CC12CCC3C(C)(CO)C(O)CCC3(C)C1CCC1C(=CC(=O)C3C(C)(CO)C(O)CCC13C)C2 |
| InChI | InChI=1S/C30H48O5/c1-26-11-8-22-28(3,13-10-23(34)29(22,4)16-31)21(26)7-6-19-18(15-26)14-20(33)25-27(19,2)12-9-24(35)30(25,5)17-32/h14,19,21-25,31-32,34-35H,6-13,15-17H2,1-5H3 |
| InChIKey | BBVAQCLKJCAZLE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.71 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |