C30H50O4 — CID 162941885
7,20-bis(hydroxymethyl)-3,7,11,16,20-pentamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-1(23)-ene-8,19-diol (PubChem CID 162941885) has the molecular formula C30H50O4 and a molecular weight of 474.73 g/mol. Its IUPAC name is 7,20-bis(hydroxymethyl)-3,7,11,16,20-pentamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-1(23)-ene-8,19-diol.
| Compound Name | 7,20-bis(hydroxymethyl)-3,7,11,16,20-pentamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-1(23)-ene-8,19-diol |
|---|---|
| PubChem CID | 162941885 |
| Molecular Formula | C30H50O4 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.37 |
| IUPAC Name | 7,20-bis(hydroxymethyl)-3,7,11,16,20-pentamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-1(23)-ene-8,19-diol |
| SMILES | CC12CCC3C(C)(CO)C(O)CCC3(C)C1CCC1C(=CCC3C(C)(CO)C(O)CCC13C)C2 |
| InChI | InChI=1S/C30H50O4/c1-26-13-10-23-28(3,15-12-25(34)30(23,5)18-32)21(26)9-7-20-19(16-26)6-8-22-27(20,2)14-11-24(33)29(22,4)17-31/h6,20-25,31-34H,7-18H2,1-5H3 |
| InChIKey | FAZJGQBGRJYILG-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|