C30H48O6 — CID 162922542
8,9,19-trihydroxy-7,20-bis(hydroxymethyl)-1,7,11,16,20-pentamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-en-5-one (PubChem CID 162922542) has the molecular formula C30H48O6 and a molecular weight of 504.71 g/mol. Its IUPAC name is 8,9,19-trihydroxy-7,20-bis(hydroxymethyl)-1,7,11,16,20-pentamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-en-5-one.
| Compound Name | 8,9,19-trihydroxy-7,20-bis(hydroxymethyl)-1,7,11,16,20-pentamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-en-5-one |
|---|---|
| PubChem CID | 162922542 |
| Molecular Formula | C30H48O6 |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.35 |
| IUPAC Name | 8,9,19-trihydroxy-7,20-bis(hydroxymethyl)-1,7,11,16,20-pentamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-en-5-one |
| SMILES | CC12CCC3C(C)(CO)C(O)CCC3(C)C1CCC1C(=CC(=O)C3C1(C)CC(O)C(O)C3(C)CO)C2 |
| InChI | InChI=1S/C30H48O6/c1-26-10-8-22-27(2,11-9-23(35)29(22,4)15-31)21(26)7-6-18-17(13-26)12-19(33)24-28(18,3)14-20(34)25(36)30(24,5)16-32/h12,18,20-25,31-32,34-36H,6-11,13-16H2,1-5H3 |
| InChIKey | UPCGCIJOLQBKBD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |