C40H56O9 — CID 163008297
[8,9,19-trihydroxy-20-(hydroxymethyl)-1,7,11,16,20-pentamethyl-5-oxo-7-pentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-enyl]methyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 163008297) has the molecular formula C40H56O9 and a molecular weight of 680.88 g/mol. Its IUPAC name is [8,9,19-trihydroxy-20-(hydroxymethyl)-1,7,11,16,20-pentamethyl-5-oxo-7-pentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-enyl]methyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | [8,9,19-trihydroxy-20-(hydroxymethyl)-1,7,11,16,20-pentamethyl-5-oxo-7-pentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-enyl]methyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 163008297 |
| Molecular Formula | C40H56O9 |
| Molecular Weight | 680.88 g/mol |
| Exact Mass | 680.39 |
| IUPAC Name | [8,9,19-trihydroxy-20-(hydroxymethyl)-1,7,11,16,20-pentamethyl-5-oxo-7-pentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-enyl]methyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(C=CC(=O)OCC2(C)C(O)C(O)CC3(C)C4CCC5C(C)(CCC6C(C)(CO)C(O)CCC56C)CC4=CC(=O)C32)ccc1O |
| InChI | InChI=1S/C40H56O9/c1-36-15-13-31-37(2,16-14-32(45)39(31,4)21-41)30(36)11-9-25-24(19-36)18-27(43)34-38(25,3)20-28(44)35(47)40(34,5)22-49-33(46)12-8-23-7-10-26(42)29(17-23)48-6/h7-8,10,12,17-18,25,28,30-32,34-35,41-42,44-45,47H,9,11,13-16,19-22H2,1-6H3 |
| InChIKey | DTYYFYAKSWDPTQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.88 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|