C31H52O3 — CID 162942351
(1S,6R,7S,8S,11R,12S,15R,16R,19S,21S)-7-(hydroxymethyl)-19-methoxy-1,7,11,16,20,20-hexamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-en-8-ol (PubChem CID 162942351) has the molecular formula C31H52O3 and a molecular weight of 472.75 g/mol. Its IUPAC name is (1S,6R,7S,8S,11R,12S,15R,16R,19S,21S)-7-(hydroxymethyl)-19-methoxy-1,7,11,16,20,20-hexamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-en-8-ol.
| Compound Name | (1S,6R,7S,8S,11R,12S,15R,16R,19S,21S)-7-(hydroxymethyl)-19-methoxy-1,7,11,16,20,20-hexamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-en-8-ol |
|---|---|
| PubChem CID | 162942351 |
| Molecular Formula | C31H52O3 |
| Molecular Weight | 472.75 g/mol |
| Exact Mass | 472.39 |
| IUPAC Name | (1S,6R,7S,8S,11R,12S,15R,16R,19S,21S)-7-(hydroxymethyl)-19-methoxy-1,7,11,16,20,20-hexamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-en-8-ol |
| SMILES | CO[C@H]1CC[C@@]2(C)[C@H](CC[C@@]3(C)CC4=CC[C@@H]5[C@](C)(CC[C@H](O)[C@]5(C)CO)[C@H]4CC[C@H]32)C1(C)C |
| InChI | InChI=1S/C31H52O3/c1-27(2)22-12-15-28(3)18-20-8-10-24-29(4,16-13-25(33)31(24,6)19-32)21(20)9-11-23(28)30(22,5)17-14-26(27)34-7/h8,21-26,32-33H,9-19H2,1-7H3/t21-,22+,23+,24+,25-,26-,28-,29+,30-,31+/m0/s1 |
| InChIKey | JUSIDDXFEXDQLL-UVEQTSDVSA-N |
| XLogP | 6.77 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.75 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|