C31H50O3 — CID 162924614
8-hydroxy-19-methoxy-1,7,7,11,16,20,20-heptamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-en-5-one (PubChem CID 162924614) has the molecular formula C31H50O3 and a molecular weight of 470.74 g/mol. Its IUPAC name is 8-hydroxy-19-methoxy-1,7,7,11,16,20,20-heptamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-en-5-one.
| Compound Name | 8-hydroxy-19-methoxy-1,7,7,11,16,20,20-heptamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-en-5-one |
|---|---|
| PubChem CID | 162924614 |
| Molecular Formula | C31H50O3 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 470.38 |
| IUPAC Name | 8-hydroxy-19-methoxy-1,7,7,11,16,20,20-heptamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-en-5-one |
| SMILES | COC1CCC2(C)C3CCC4C(=CC(=O)C5C(C)(C)C(O)CCC45C)CC3(C)CCC2C1(C)C |
| InChI | InChI=1S/C31H50O3/c1-27(2)22-11-14-29(5)18-19-17-21(32)26-28(3,4)24(33)12-15-30(26,6)20(19)9-10-23(29)31(22,7)16-13-25(27)34-8/h17,20,22-26,33H,9-16,18H2,1-8H3 |
| InChIKey | UGGBNJIWBHUVTN-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |