C18H30O2 — CID 101238924
(3aR,5aS,7S,9aR,9bR)-7-methoxy-3a,6,6,9a-tetramethyl-3,4,5,5a,7,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-2-one (PubChem CID 101238924) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is (3aR,5aS,7S,9aR,9bR)-7-methoxy-3a,6,6,9a-tetramethyl-3,4,5,5a,7,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-2-one.
| Compound Name | (3aR,5aS,7S,9aR,9bR)-7-methoxy-3a,6,6,9a-tetramethyl-3,4,5,5a,7,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-2-one |
|---|---|
| PubChem CID | 101238924 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (3aR,5aS,7S,9aR,9bR)-7-methoxy-3a,6,6,9a-tetramethyl-3,4,5,5a,7,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-2-one |
| SMILES | CO[C@H]1CC[C@@]2(C)[C@H](CC[C@]3(C)CC(=O)C[C@H]32)C1(C)C |
| InChI | InChI=1S/C18H30O2/c1-16(2)13-6-8-17(3)11-12(19)10-14(17)18(13,4)9-7-15(16)20-5/h13-15H,6-11H2,1-5H3/t13-,14-,15+,17-,18+/m1/s1 |
| InChIKey | XQCRWZGRWPRUOG-XHHISWJOSA-N |
| XLogP | 4.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |