C17H26O2 — CID 101034993
(5aR,7S,9aR,9bR)-7-methoxy-6,6,9a-trimethyl-1,4,5,5a,7,8,9,9b-octahydrocyclopenta[a]naphthalen-2-one (PubChem CID 101034993) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is (5aR,7S,9aR,9bR)-7-methoxy-6,6,9a-trimethyl-1,4,5,5a,7,8,9,9b-octahydrocyclopenta[a]naphthalen-2-one.
| Compound Name | (5aR,7S,9aR,9bR)-7-methoxy-6,6,9a-trimethyl-1,4,5,5a,7,8,9,9b-octahydrocyclopenta[a]naphthalen-2-one |
|---|---|
| PubChem CID | 101034993 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | (5aR,7S,9aR,9bR)-7-methoxy-6,6,9a-trimethyl-1,4,5,5a,7,8,9,9b-octahydrocyclopenta[a]naphthalen-2-one |
| SMILES | CO[C@H]1CC[C@]2(C)[C@@H]3CC(=O)C=C3CC[C@H]2C1(C)C |
| InChI | InChI=1S/C17H26O2/c1-16(2)14-6-5-11-9-12(18)10-13(11)17(14,3)8-7-15(16)19-4/h9,13-15H,5-8,10H2,1-4H3/t13-,14+,15+,17-/m1/s1 |
| InChIKey | FHWUZHOMDRUZNY-WBTNSWJXSA-N |
| XLogP | 3.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |