C18H28O2 — CID 153011722
(4aR,4bS,7R,8S,8aS)-8-ethyl-7-hydroxy-4b,8-dimethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-one (PubChem CID 153011722) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is (4aR,4bS,7R,8S,8aS)-8-ethyl-7-hydroxy-4b,8-dimethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-one.
| Compound Name | (4aR,4bS,7R,8S,8aS)-8-ethyl-7-hydroxy-4b,8-dimethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-one |
|---|---|
| PubChem CID | 153011722 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | (4aR,4bS,7R,8S,8aS)-8-ethyl-7-hydroxy-4b,8-dimethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-one |
| SMILES | CC[C@@]1(C)[C@H]2CCC3=CC(=O)CC[C@H]3[C@]2(C)CC[C@H]1O |
| InChI | InChI=1S/C18H28O2/c1-4-17(2)15-8-5-12-11-13(19)6-7-14(12)18(15,3)10-9-16(17)20/h11,14-16,20H,4-10H2,1-3H3/t14-,15-,16-,17+,18+/m1/s1 |
| InChIKey | VAENTOLMAVYGLI-DZVNLGKHSA-N |
| XLogP | 3.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |