C31H50O2 — CID 163022928
(3S,6R,11R,12S,16S,19R,21S)-19-methoxy-3,7,7,11,16,20,20-heptamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-1(15)-en-8-one (PubChem CID 163022928) has the molecular formula C31H50O2 and a molecular weight of 454.74 g/mol. Its IUPAC name is (3S,6R,11R,12S,16S,19R,21S)-19-methoxy-3,7,7,11,16,20,20-heptamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-1(15)-en-8-one.
| Compound Name | (3S,6R,11R,12S,16S,19R,21S)-19-methoxy-3,7,7,11,16,20,20-heptamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-1(15)-en-8-one |
|---|---|
| PubChem CID | 163022928 |
| Molecular Formula | C31H50O2 |
| Molecular Weight | 454.74 g/mol |
| Exact Mass | 454.38 |
| IUPAC Name | (3S,6R,11R,12S,16S,19R,21S)-19-methoxy-3,7,7,11,16,20,20-heptamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-1(15)-en-8-one |
| SMILES | CO[C@@H]1CC[C@]2(C)C3=C(CC[C@@H]2C1(C)C)C[C@]1(C)CC[C@H]2C(C)(C)C(=O)CC[C@]2(C)[C@H]1CC3 |
| InChI | InChI=1S/C31H50O2/c1-27(2)23-13-16-29(5)19-20-9-11-22-28(3,4)26(33-8)15-18-30(22,6)21(20)10-12-24(29)31(23,7)17-14-25(27)32/h22-24,26H,9-19H2,1-8H3/t22-,23+,24+,26-,29+,30-,31+/m1/s1 |
| InChIKey | KLHCNYCAHCOQFG-SCIYOOMKSA-N |
| XLogP | 8.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.74 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|