C22H30O3 — CID 88556931
(4aS,6aS,11aS,11bS)-7-hydroxy-9-methoxy-4,4,6a,11b-tetramethyl-2,4a,5,6,11,11a-hexahydro-1H-benzo[a]fluoren-3-one (PubChem CID 88556931) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is (4aS,6aS,11aS,11bS)-7-hydroxy-9-methoxy-4,4,6a,11b-tetramethyl-2,4a,5,6,11,11a-hexahydro-1H-benzo[a]fluoren-3-one.
| Compound Name | (4aS,6aS,11aS,11bS)-7-hydroxy-9-methoxy-4,4,6a,11b-tetramethyl-2,4a,5,6,11,11a-hexahydro-1H-benzo[a]fluoren-3-one |
|---|---|
| PubChem CID | 88556931 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (4aS,6aS,11aS,11bS)-7-hydroxy-9-methoxy-4,4,6a,11b-tetramethyl-2,4a,5,6,11,11a-hexahydro-1H-benzo[a]fluoren-3-one |
| SMILES | COc1cc(O)c2c(c1)C[C@H]1[C@]3(C)CCC(=O)C(C)(C)[C@H]3CC[C@]21C |
| InChI | InChI=1S/C22H30O3/c1-20(2)16-6-8-22(4)17(21(16,3)9-7-18(20)24)11-13-10-14(25-5)12-15(23)19(13)22/h10,12,16-17,23H,6-9,11H2,1-5H3/t16-,17+,21-,22+/m1/s1 |
| InChIKey | YWNTVYSYNXJRPH-XQTRSNPVSA-N |
| XLogP | 4.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |